![[ICO]](/icons/blank.gif){kind=icon}
|
Name | Last modified | Size | Description |
|---|---|---|---|---|
|
Parent Directory | - | ||
|
A-zu-ra & DDRKirby(ISQ) | 20-Apr-2018 16:20 | - | |
|
A.M.S. Crew | 20-Apr-2018 16:20 | - | |
|
AZ‐Rotator vs. Kenji Siratori | 20-Apr-2018 16:20 | - | |
|
Adeline Tomasone | 20-Apr-2018 16:20 | - | |
|
Aditya Verma | 20-Apr-2018 16:20 | - | |
|
Aidan Baker & Ultra Milkmaids | 20-Apr-2018 16:20 | - | |
|
Akio Suzuki & David Toop | 20-Apr-2018 16:20 | - | |
|
Alexi Delano | 20-Apr-2018 16:20 | - | |
|
Ali Lohan | 20-Apr-2018 16:20 | - | |
|
Amade' String Orchestra | 20-Apr-2018 16:20 | - | |
|
American Fiction | 20-Apr-2018 16:20 | - | |
|
Analyzer | 20-Apr-2018 16:20 | - | |
|
Aniceto do Império | 20-Apr-2018 16:20 | - | |
|
Anna Luca | 20-Apr-2018 16:20 | - | |
|
Ari Jr. | 20-Apr-2018 16:20 | - | |
|
Aristo | 20-Apr-2018 16:20 | - | |
|
Asher Lev | 20-Apr-2018 16:20 | - | |
|
Atakku | 20-Apr-2018 16:20 | - | |
|
Atria | 20-Apr-2018 16:20 | - | |
|
Attaloss | 20-Apr-2018 16:20 | - | |
|
Avith | 20-Apr-2018 16:20 | - | |
|
BB Swing | 20-Apr-2018 16:20 | - | |
|
BTH | 20-Apr-2018 16:20 | - | |
|
Banach & Indios Bravos | 20-Apr-2018 16:20 | - | |
|
Barbara Buchholz | 20-Apr-2018 16:20 | - | |
|
Basic Rhythm | 20-Apr-2018 16:20 | - | |
|
Beer Bear | 20-Apr-2018 16:20 | - | |
|
Bernie Williams | 20-Apr-2018 16:20 | - | |
|
Beta Two Agonist | 20-Apr-2018 16:20 | - | |
|
Beyond Fallen | 20-Apr-2018 16:20 | - | |
|
Bill Stafford | 20-Apr-2018 16:20 | - | |
|
Bird of Prey | 20-Apr-2018 16:20 | - | |
|
Blinder | 20-Apr-2018 16:20 | - | |
|
Bobby Kray | 20-Apr-2018 16:20 | - | |
|
Bolus | 20-Apr-2018 16:20 | - | |
|
Boonk | 20-Apr-2018 16:20 | - | |
|
Boris Parker | 20-Apr-2018 16:20 | - | |
|
Carson Cole | 20-Apr-2018 16:20 | - | |
|
Ceasefire | 20-Apr-2018 16:20 | - | |
|
Chocolate Spoon | 20-Apr-2018 16:20 | - | |
|
Chris White | 20-Apr-2018 16:20 | - | |
|
Chrissie O'Dell & One Hot Mess | 20-Apr-2018 16:20 | - | |
|
Christian Bobin | 20-Apr-2018 16:20 | - | |
|
Christmas Baubles | 20-Apr-2018 16:20 | - | |
|
Claudio "El Compadre" | 20-Apr-2018 16:20 | - | |
|
Cloudcraft | 20-Apr-2018 16:20 | - | |
|
Cousin Walter | 20-Apr-2018 16:20 | - | |
|
D:Exter | 20-Apr-2018 16:20 | - | |
|
DJ Brainwash | 20-Apr-2018 16:20 | - | |
|
DJ Fresh feat. Stamina MC & Koko | 20-Apr-2018 16:20 | - | |
|
DJ Kool Breeze | 20-Apr-2018 16:20 | - | |
|
DJ Merritt | 20-Apr-2018 16:20 | - | |
|
Daghan Baydur & Richard Thomas | 20-Apr-2018 16:20 | - | |
|
Daniel Wade | 20-Apr-2018 16:20 | - | |
|
Das Ossip-Tschechow-Ensemble | 20-Apr-2018 16:20 | - | |
|
Dauga | 20-Apr-2018 16:20 | - | |
|
David King | 20-Apr-2018 16:20 | - | |
|
David Lowery | 20-Apr-2018 16:20 | - | |
|
David Reilly | 20-Apr-2018 16:20 | - | |
|
De Groothandel & Co. | 20-Apr-2018 16:20 | - | |
|
Diesel Christ | 20-Apr-2018 16:20 | - | |
|
Dildo Warheads | 20-Apr-2018 16:20 | - | |
|
Dillon Smith | 20-Apr-2018 16:20 | - | |
|
Discordia | 20-Apr-2018 16:20 | - | |
|
Divergence Vocal Theater | 20-Apr-2018 16:20 | - | |
|
Dom Irerra | 20-Apr-2018 16:20 | - | |
|
Dr (dr)one | 20-Apr-2018 16:20 | - | |
|
Dreamphish | 20-Apr-2018 16:20 | - | |
|
Dry Livers | 20-Apr-2018 16:20 | - | |
|
Duck's Breath Mystery Theatre | 20-Apr-2018 16:20 | - | |
|
Dzyan | 20-Apr-2018 16:20 | - | |
|
Elm | 20-Apr-2018 16:20 | - | |
|
Emile Hermansen | 20-Apr-2018 16:20 | - | |
|
Emperors New Clothes | 20-Apr-2018 16:20 | - | |
|
Ernie Stires | 20-Apr-2018 16:20 | - | |
|
Everything Was Perfect | 20-Apr-2018 16:20 | - | |
|
Eyan & The Truth | 20-Apr-2018 16:20 | - | |
|
Florent Vintrigner | 20-Apr-2018 16:20 | - | |
|
Françoise Cactus | 20-Apr-2018 16:20 | - | |
|
Full | 20-Apr-2018 16:20 | - | |
|
Fusion | 20-Apr-2018 16:20 | - | |
|
Fuzzy Jupiter | 20-Apr-2018 16:20 | - | |
|
Games | 20-Apr-2018 16:20 | - | |
|
Gary Thomas | 20-Apr-2018 16:20 | - | |
|
Getz & Nuage | 20-Apr-2018 16:20 | - | |
|
Gildas & Masaya | 20-Apr-2018 16:20 | - | |
|
Glow Marrow | 20-Apr-2018 16:20 | - | |
|
Greetje Bijma | 20-Apr-2018 16:20 | - | |
|
Gulan | 20-Apr-2018 16:20 | - | |
|
HaTachtonim | 20-Apr-2018 16:20 | - | |
|
Heebee Jeebeez | 20-Apr-2018 16:20 | - | |
|
Heeren Stevens | 20-Apr-2018 16:20 | - | |
|
Hildur Gudnadóttir, BJ Nilsen & Stilluppsteypa | 20-Apr-2018 16:20 | - | |
|
Hydraulic Spankers | 20-Apr-2018 16:20 | - | |
|
I Am In Love | 20-Apr-2018 16:20 | - | |
|
J J Tyrell | 20-Apr-2018 16:20 | - | |
|
J.D. Blair | 20-Apr-2018 16:20 | - | |
|
Jacinta | 20-Apr-2018 16:20 | - | |
|
Jason Kessler | 20-Apr-2018 16:20 | - | |
|
Jinder Jinda | 20-Apr-2018 16:20 | - | |
|
Johanna Sillanpaa | 20-Apr-2018 16:20 | - | |
|
Johnny G | 20-Apr-2018 16:20 | - | |
|
KIIS | 20-Apr-2018 16:20 | - | |
|
Kanoe | 20-Apr-2018 16:20 | - | |
|
Kirrin Island | 20-Apr-2018 16:20 | - | |
|
Koks Band | 20-Apr-2018 16:20 | - | |
|
Kridthuset | 20-Apr-2018 16:20 | - | |
|
Krunch | 20-Apr-2018 16:20 | - | |
|
Kukerpillid, Mari Pokinen & Hendrik Sal-Saller | 20-Apr-2018 16:20 | - | |
|
L33tStr33t Boys | 20-Apr-2018 16:20 | - | |
|
La K'onga | 20-Apr-2018 16:20 | - | |
|
Lame Ingineers | 20-Apr-2018 16:20 | - | |
|
Landscape Izuma | 20-Apr-2018 16:20 | - | |
|
Lawnie Wallace | 20-Apr-2018 16:20 | - | |
|
Le Cœur des Femmes | 20-Apr-2018 16:20 | - | |
|
Legion of Parasites | 20-Apr-2018 16:20 | - | |
|
Leila Negra & der Wiener Kinderchor | 20-Apr-2018 16:20 | - | |
|
Leo De Kraai | 20-Apr-2018 16:20 | - | |
|
Lilypad | 20-Apr-2018 16:20 | - | |
|
Linnea och Lihkören | 20-Apr-2018 16:20 | - | |
|
Lio & Jacky | 20-Apr-2018 16:20 | - | |
|
Lóchrann | 20-Apr-2018 16:20 | - | |
|
Magnus Tengdahl | 20-Apr-2018 16:20 | - | |
|
Mahumodo | 20-Apr-2018 16:20 | - | |
|
Malkit Hirdapuria | 20-Apr-2018 16:20 | - | |
|
Man and Machines | 20-Apr-2018 16:20 | - | |
|
Marc Copland, Kenny Wheeler & John Abercrombie | 20-Apr-2018 16:20 | - | |
|
Mark Hewer | 20-Apr-2018 16:20 | - | |
|
Marko Naissoo | 20-Apr-2018 16:20 | - | |
|
Masahiko Kimura, Norikazu Miura, Michiru Yamane | 20-Apr-2018 16:20 | - | |
|
Masseratti 2lts | 20-Apr-2018 16:20 | - | |
|
Material, Whitney Houston feat. Archie Shepp | 20-Apr-2018 16:20 | - | |
|
Michaël | 20-Apr-2018 16:20 | - | |
|
Michu | 20-Apr-2018 16:20 | - | |
|
Miina ja Manu | 20-Apr-2018 16:20 | - | |
|
Modest D | 20-Apr-2018 16:20 | - | |
|
Morbid Death | 20-Apr-2018 16:20 | - | |
|
Mynas | 20-Apr-2018 16:20 | - | |
|
N-Groove | 20-Apr-2018 16:20 | - | |
|
Nachtgeblüt | 20-Apr-2018 16:20 | - | |
|
Neongod | 20-Apr-2018 16:20 | - | |
|
Ngobo Ngobo | 20-Apr-2018 16:20 | - | |
|
Nightforce | 20-Apr-2018 16:20 | - | |
|
Noise Ratchet | 20-Apr-2018 16:20 | - | |
|
Old Man River | 20-Apr-2018 16:20 | - | |
|
Organized Chaos | 20-Apr-2018 16:20 | - | |
|
Ostarbeiter | 20-Apr-2018 16:20 | - | |
|
Over the Transom | 20-Apr-2018 16:20 | - | |
|
Pan Sonic & Haino Keiji | 20-Apr-2018 16:20 | - | |
|
Paolo Fresu ⁄ A Filetta Corsican Voices ⁄ Daniele di Bonaventura | 20-Apr-2018 16:20 | - | |
|
Paul Cole | 20-Apr-2018 16:20 | - | |
|
Perquisite feat. Benjamin Herman | 20-Apr-2018 16:20 | - | |
|
Perry Como with Mitchell Ayres and His Orchestra | 20-Apr-2018 16:20 | - | |
|
Philipp Fankhauser & Checkerboard Blues Band | 20-Apr-2018 16:20 | - | |
|
Phosphor | 20-Apr-2018 16:20 | - | |
|
Public Property | 20-Apr-2018 16:20 | - | |
|
Pulse Programming | 20-Apr-2018 16:20 | - | |
|
Radio Lukas | 20-Apr-2018 16:20 | - | |
|
Rake Wickman | 20-Apr-2018 16:20 | - | |
|
Raul Cremona | 20-Apr-2018 16:20 | - | |
|
Reamonn & Lucie Silvas | 20-Apr-2018 16:20 | - | |
|
Rebattered | 20-Apr-2018 16:20 | - | |
|
Red & Jo | 20-Apr-2018 16:20 | - | |
|
Red Bee Society | 20-Apr-2018 16:20 | - | |
|
Revenge Club | 20-Apr-2018 16:20 | - | |
|
Rh+ | 20-Apr-2018 16:20 | - | |
|
Royal Hill | 20-Apr-2018 16:20 | - | |
|
Ruffnexx Sound System | 20-Apr-2018 16:20 | - | |
|
Rufus Thomas & Carla Thomas | 20-Apr-2018 16:20 | - | |
|
S. T. Cowell, Keith Leary & D. P. Murrant | 20-Apr-2018 16:20 | - | |
|
Sakred Plague | 20-Apr-2018 16:20 | - | |
|
Samuli Edelmann & Mikko Kuustonen | 20-Apr-2018 16:20 | - | |
|
Santana feat. Alex Band of The Calling | 20-Apr-2018 16:20 | - | |
|
Scala | 20-Apr-2018 16:20 | - | |
|
Schwabinggrad Ballett | 20-Apr-2018 16:20 | - | |
|
Selection | 20-Apr-2018 16:20 | - | |
|
Seán Cullen | 20-Apr-2018 16:20 | - | |
|
Shane Yellowbird | 20-Apr-2018 16:20 | - | |
|
Skuobhie Dubh Orchestra | 20-Apr-2018 16:20 | - | |
|
Slim Dusty with The Travelling Country Band | 20-Apr-2018 16:20 | - | |
|
Sol'Jibe | 20-Apr-2018 16:20 | - | |
|
Solar Dawn | 20-Apr-2018 16:20 | - | |
|
Solicide | 20-Apr-2018 16:20 | - | |
|
Somatic | 20-Apr-2018 16:20 | - | |
|
Soñar | 20-Apr-2018 16:20 | - | |
|
Space DJz | 20-Apr-2018 16:20 | - | |
|
Stan Hugill | 20-Apr-2018 16:20 | - | |
|
Stroke of Genius | 20-Apr-2018 16:20 | - | |
|
Sunrise Elementary | 20-Apr-2018 16:20 | - | |
|
THE RODEO CARBURETTOR | 20-Apr-2018 16:20 | - | |
|
Teebs & Jackhigh | 20-Apr-2018 16:20 | - | |
|
Tempelhof | 20-Apr-2018 16:20 | - | |
|
Teo Azevedo | 20-Apr-2018 16:20 | - | |
|
Terry Brock | 20-Apr-2018 16:20 | - | |
|
The Agitators | 20-Apr-2018 16:20 | - | |
|
The Album Leaf & Bright Eyes | 20-Apr-2018 16:20 | - | |
|
The Ashley Alexander Big Band | 20-Apr-2018 16:20 | - | |
|
The Cal Hopkins Amish Armada | 20-Apr-2018 16:20 | - | |
|
The Camels | 20-Apr-2018 16:20 | - | |
|
The Chemistry Experiment | 20-Apr-2018 16:20 | - | |
|
The Crystal Pharoah | 20-Apr-2018 16:20 | - | |
|
The Dead Jivaro | 20-Apr-2018 16:20 | - | |
|
The Eclectic Collective | 20-Apr-2018 16:20 | - | |
|
The Enjoys | 20-Apr-2018 16:20 | - | |
|
The Foremen | 20-Apr-2018 16:20 | - | |
|
The Head Shop | 20-Apr-2018 16:20 | - | |
|
The Heathens | 20-Apr-2018 16:20 | - | |
|
The Jellyfish Kiss | 20-Apr-2018 16:20 | - | |
|
The Jolly Rogues | 20-Apr-2018 16:20 | - | |
|
The Junction | 20-Apr-2018 16:20 | - | |
|
The Kuntautcult | 20-Apr-2018 16:20 | - | |
|
The Last Tribe | 20-Apr-2018 16:20 | - | |
|
The Meek | 20-Apr-2018 16:20 | - | |
|
The Naughty Ones | 20-Apr-2018 16:20 | - | |
|
The Redeemer | 20-Apr-2018 16:20 | - | |
|
The Secret Handshake | 20-Apr-2018 16:20 | - | |
|
The Showboys | 20-Apr-2018 16:20 | - | |
|
The Stoodes | 20-Apr-2018 16:20 | - | |
|
The Wet Penguins | 20-Apr-2018 16:20 | - | |
|
Tim Key | 20-Apr-2018 16:20 | - | |
|
Tinnitus | 20-Apr-2018 16:20 | - | |
|
Tom Doyle | 20-Apr-2018 16:20 | - | |
|
Tom Waits & Kronos Quartet | 20-Apr-2018 16:20 | - | |
|
Tony Randall and Jack Klugman | 20-Apr-2018 16:20 | - | |
|
Tory Cassis | 20-Apr-2018 16:20 | - | |
|
Toy Factory | 20-Apr-2018 16:20 | - | |
|
Tuk Tuk Rally | 20-Apr-2018 16:20 | - | |
|
Twyster | 20-Apr-2018 16:20 | - | |
|
Tyr | 20-Apr-2018 16:20 | - | |
|
U Turn | 20-Apr-2018 16:20 | - | |
|
Unhallowed | 20-Apr-2018 16:20 | - | |
|
Vespercellos | 20-Apr-2018 16:20 | - | |
|
Vulturum | 20-Apr-2018 16:20 | - | |
|
WSNB | 20-Apr-2018 16:20 | - | |
|
Willie Smith | 20-Apr-2018 16:20 | - | |
|
Wisby Vaganter | 20-Apr-2018 16:20 | - | |
|
Witch's Hat | 20-Apr-2018 16:20 | - | |
|
Woodie Alien | 20-Apr-2018 16:20 | - | |
|
Yellowbird | 20-Apr-2018 16:20 | - | |
|
Ythad | 20-Apr-2018 16:20 | - | |
|
Yvette Giraud and les Quatre de Paris | 20-Apr-2018 16:20 | - | |
|
Zillawilla | 20-Apr-2018 16:20 | - | |
|
ibuki yushi | 20-Apr-2018 16:20 | - | |
|
Äl Jawala feat. Flo Mega | 20-Apr-2018 16:20 | - | |
|
Παρεμβολές | 20-Apr-2018 16:20 | - | |
|
Светлояр | 20-Apr-2018 16:20 | - | |
|
Сегодня в Мире | 20-Apr-2018 16:20 | - | |
|
שב״ק ס׳ | 20-Apr-2018 16:20 | - | |
|
ザ・ルーズドッグス feat. 大黒摩季 | 20-Apr-2018 16:20 | - | |
|
桂文我 | 20-Apr-2018 16:20 | - | |